HA protein inhibitor 1
Product number BW059989
| CAS | 346715-10-4 |
|---|---|
| Molecular formula | C15H15Cl2NO2S |
| Molecular weight | 344.263 |
| SMILES | CCN(c1ccccc1C)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChIKey | LQAXYXRILKSWNR-UHFFFAOYSA-N |
| Purity | Specifications subject to inquiry |
| Synonyms | GLXC-24284; 2,5-dichloro-N-ethyl-N-(2-methylphenyl)benzenesulfonamide |
Packaging
Typical pack sizes are listed for reference; actual packaging and specifications are confirmed on inquiry.
| Pack size | Availability |
|---|---|
| 10g | Request quotation |
| 50g | Request quotation |
| 250g | Request quotation |
| 1kg | Request quotation |
| 5kg | Request quotation |