L-Alanine, N ,N '-phosphinicobis-, 1,1'-bis(1-methylethyl) ester, 5'-ester with 4-amino-1-[4-C -(difluoromethyl)-
Product number BW111432
| CAS | 1803136-30-2 |
|---|---|
| Molecular formula | C22H36F2N5O10P |
| Molecular weight | 599.525 |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=O)(N[C@H](C)C(=O)OC(C)C)OC[C@]1(C(F)F)O[C@H](n2ccc(N)nc2=O)[C@@H](O)[C@@H]1O |
| InChIKey | PGDTXRFAPUTLCA-BBKJFJFHSA-N |
| Purity | Specifications subject to inquiry |
| Synonyms | A-D-xylofuranosyl]-2(1H )-pyrimidinone |
Packaging
Typical pack sizes are listed for reference; actual packaging and specifications are confirmed on inquiry.
| Pack size | Availability |
|---|---|
| 10g | Request quotation |
| 50g | Request quotation |
| 250g | Request quotation |
| 1kg | Request quotation |
| 5kg | Request quotation |