2-Hexenoic acid, 4-[[(2S)-2-amino-3,3-dimethyl-1-oxobutyl]methylamino]-2,5-dimethyl-, ethyl ester, monohydrochloride, (2E,4S)-
Product number BW156446
| CAS | 610786-70-4 |
|---|---|
| Molecular formula | C17H33ClN2O3 |
| Molecular weight | 348.915 |
| SMILES | CCOC(=O)/C(C)=C/[C@H](C(C)C)N(C)C(=O)[C@@H](N)C(C)(C)C.Cl |
| InChIKey | ODRXOMQLUFDMLT-OHFIRJTNSA-N |
| Purity | Specifications subject to inquiry |
Packaging
Typical pack sizes are listed for reference; actual packaging and specifications are confirmed on inquiry.
| Pack size | Availability |
|---|---|
| 10g | Request quotation |
| 50g | Request quotation |
| 250g | Request quotation |
| 1kg | Request quotation |
| 5kg | Request quotation |